C15H2F26O4 — CID 169091840
2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)-2-(1,1,2,2,2-pentafluoroethyl)propanedioic acid (PubChem CID 169091840) has the molecular formula C15H2F26O4 and a molecular weight of 740.12 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)-2-(1,1,2,2,2-pentafluoroethyl)propanedioic acid.
| Compound Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)-2-(1,1,2,2,2-pentafluoroethyl)propanedioic acid |
|---|---|
| PubChem CID | 169091840 |
| Molecular Formula | C15H2F26O4 |
| Molecular Weight | 740.12 g/mol |
| Exact Mass | 739.95 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)-2-(1,1,2,2,2-pentafluoroethyl)propanedioic acid |
| SMILES | O=C(O)C(C(=O)O)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H2F26O4/c16-4(17,3(1(42)43,2(44)45)5(18,19)14(36,37)38)6(20,21)7(22,23)8(24,25)9(26,27)10(28,29)11(30,31)12(32,33)13(34,35)15(39,40)41/h(H,42,43)(H,44,45) |
| InChIKey | JLVQEKGJUBFCOU-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.12 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|