C10HF19O2 — CID 139972180
3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2,2-bis(trifluoromethyl)octanoic acid (PubChem CID 139972180) has the molecular formula C10HF19O2 and a molecular weight of 514.08 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2,2-bis(trifluoromethyl)octanoic acid.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2,2-bis(trifluoromethyl)octanoic acid |
|---|---|
| PubChem CID | 139972180 |
| Molecular Formula | C10HF19O2 |
| Molecular Weight | 514.08 g/mol |
| Exact Mass | 513.97 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-2,2-bis(trifluoromethyl)octanoic acid |
| SMILES | O=C(O)C(C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10HF19O2/c11-3(12,2(1(30)31,8(21,22)23)9(24,25)26)4(13,14)5(15,16)6(17,18)7(19,20)10(27,28)29/h(H,30,31) |
| InChIKey | OQGJDJHNRJJZSJ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.08 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|