C8F14O4Zn — CID 87694788
zinc bis(2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanoate) (PubChem CID 87694788) has the molecular formula C8F14O4Zn and a molecular weight of 491.45 g/mol. Its IUPAC name is zinc bis(2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanoate).
| Compound Name | zinc bis(2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanoate) |
|---|---|
| PubChem CID | 87694788 |
| Molecular Formula | C8F14O4Zn |
| Molecular Weight | 491.45 g/mol |
| Exact Mass | 489.89 |
| IUPAC Name | zinc bis(2,3,3,3-tetrafluoro-2-(trifluoromethyl)propanoate) |
| SMILES | O=C([O-])C(F)(C(F)(F)F)C(F)(F)F.O=C([O-])C(F)(C(F)(F)F)C(F)(F)F.[Zn+2] |
| InChI | InChI=1S/2C4HF7O2.Zn/c2*5-2(1(12)13,3(6,7)8)4(9,10)11;/h2*(H,12,13);/q;;+2/p-2 |
| InChIKey | BOFXGMKDYXQIOO-UHFFFAOYSA-L |
| XLogP | 1.14 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.45 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|