C2H2F3NaO3 — CID 141088528
sodium;2,2,2-trifluoroacetate;hydrate (PubChem CID 141088528) has the molecular formula C2H2F3NaO3 and a molecular weight of 154.02 g/mol. Its IUPAC name is sodium;2,2,2-trifluoroacetate;hydrate.
| Compound Name | sodium;2,2,2-trifluoroacetate;hydrate |
|---|---|
| PubChem CID | 141088528 |
| Molecular Formula | C2H2F3NaO3 |
| Molecular Weight | 154.02 g/mol |
| Exact Mass | 153.99 |
| IUPAC Name | sodium;2,2,2-trifluoroacetate;hydrate |
| SMILES | O.O=C([O-])C(F)(F)F.[Na+] |
| InChI | InChI=1S/C2HF3O2.Na.H2O/c3-2(4,5)1(6)7;;/h(H,6,7);;1H2/q;+1;/p-1 |
| InChIKey | DBMXOPPBVGAPBU-UHFFFAOYSA-M |
| XLogP | -4.52 |
| TPSA | 71.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.02 |
| LogP ≤ 5 | -4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |