C3H5F3N2O3 — CID 139614468
carbamoylazanium;2,2,2-trifluoroacetate (PubChem CID 139614468) has the molecular formula C3H5F3N2O3 and a molecular weight of 174.08 g/mol. Its IUPAC name is carbamoylazanium;2,2,2-trifluoroacetate.
| Compound Name | carbamoylazanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 139614468 |
| Molecular Formula | C3H5F3N2O3 |
| Molecular Weight | 174.08 g/mol |
| Exact Mass | 174.03 |
| IUPAC Name | carbamoylazanium;2,2,2-trifluoroacetate |
| SMILES | NC([NH3+])=O.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C2HF3O2.CH4N2O/c3-2(4,5)1(6)7;2-1(3)4/h(H,6,7);(H4,2,3,4) |
| InChIKey | USIVMVHZRCKJGX-UHFFFAOYSA-N |
| XLogP | -2.39 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.08 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |