About carbamoylazanium;oxalate
carbamoylazanium;oxalate (PubChem CID 135764617) has the molecular formula C4H10N4O6
and a molecular weight of 210.15 g/mol. Its IUPAC name is carbamoylazanium;oxalate.
Molecular Properties
| Compound Name | carbamoylazanium;oxalate |
| PubChem CID | 135764617 |
| Molecular Formula | C4H10N4O6 |
| Molecular Weight | 210.15 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | carbamoylazanium;oxalate |
| SMILES | NC([NH3+])=O.NC([NH3+])=O.O=C([O-])C(=O)[O-] |
| InChI | InChI=1S/C2H2O4.2CH4N2O/c3-1(4)2(5)6;2*2-1(3)4/h(H,3,4)(H,5,6);2*(H4,2,3,4) |
| InChIKey | FHNVHAXLRLSCAN-UHFFFAOYSA-N |
| XLogP | -6.90 |
| TPSA | 221.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.15 |
| LogP ≤ 5 | -6.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze carbamoylazanium;oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamoylazanium;oxalate?
The IUPAC name of carbamoylazanium;oxalate (CID 135764617) is carbamoylazanium;oxalate.
What is the SMILES notation for carbamoylazanium;oxalate?
The canonical SMILES for carbamoylazanium;oxalate is NC([NH3+])=O.NC([NH3+])=O.O=C([O-])C(=O)[O-].
What is the InChIKey of carbamoylazanium;oxalate?
The InChIKey is FHNVHAXLRLSCAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2O4.2CH4N2O/c3-1(4)2(5)6;2*2-1(3)4/h(H,3,4)(H,5,6);2*(H4,2,3,4).
What are the key properties of carbamoylazanium;oxalate?
carbamoylazanium;oxalate has a molecular weight of 210.15 g/mol, XLogP of -6.90, 0 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for carbamoylazanium;oxalate is sourced from PubChem (CID 135764617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).