C4F6O4Sm-2 — CID 22462012
samarium;bis(2,2,2-trifluoroacetate) (PubChem CID 22462012) has the molecular formula C4F6O4Sm-2 and a molecular weight of 376.39 g/mol. Its IUPAC name is samarium;bis(2,2,2-trifluoroacetate).
| Compound Name | samarium;bis(2,2,2-trifluoroacetate) |
|---|---|
| PubChem CID | 22462012 |
| Molecular Formula | C4F6O4Sm-2 |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 377.89 |
| IUPAC Name | samarium;bis(2,2,2-trifluoroacetate) |
| SMILES | O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F.[Sm] |
| InChI | InChI=1S/2C2HF3O2.Sm/c2*3-2(4,5)1(6)7;/h2*(H,6,7);/p-2 |
| InChIKey | YEZNUBSEQJWCOY-UHFFFAOYSA-L |
| XLogP | -1.40 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |