C2F3O3Ti+ — CID 157418814
oxygen(2-);titanium(4+);2,2,2-trifluoroacetate (PubChem CID 157418814) has the molecular formula C2F3O3Ti+ and a molecular weight of 176.88 g/mol. Its IUPAC name is oxygen(2-);titanium(4+);2,2,2-trifluoroacetate.
| Compound Name | oxygen(2-);titanium(4+);2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 157418814 |
| Molecular Formula | C2F3O3Ti+ |
| Molecular Weight | 176.88 g/mol |
| Exact Mass | 176.93 |
| IUPAC Name | oxygen(2-);titanium(4+);2,2,2-trifluoroacetate |
| SMILES | O=C([O-])C(F)(F)F.[O-2].[Ti+4] |
| InChI | InChI=1S/C2HF3O2.O.Ti/c3-2(4,5)1(6)7;;/h(H,6,7);;/q;-2;+4/p-1 |
| InChIKey | BPDZLUHIRYAMHV-UHFFFAOYSA-M |
| XLogP | -0.82 |
| TPSA | 68.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.88 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |