C2H3F3KO6P — CID 175199303
potassium;phosphoric acid;2,2,2-trifluoroacetate (PubChem CID 175199303) has the molecular formula C2H3F3KO6P and a molecular weight of 250.11 g/mol. Its IUPAC name is potassium;phosphoric acid;2,2,2-trifluoroacetate.
| Compound Name | potassium;phosphoric acid;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 175199303 |
| Molecular Formula | C2H3F3KO6P |
| Molecular Weight | 250.11 g/mol |
| Exact Mass | 249.93 |
| IUPAC Name | potassium;phosphoric acid;2,2,2-trifluoroacetate |
| SMILES | O=C([O-])C(F)(F)F.O=P(O)(O)O.[K+] |
| InChI | InChI=1S/C2HF3O2.K.H3O4P/c3-2(4,5)1(6)7;;1-5(2,3)4/h(H,6,7);;(H3,1,2,3,4)/q;+1;/p-1 |
| InChIKey | AKGOHNTVGXQMGU-UHFFFAOYSA-M |
| XLogP | -4.63 |
| TPSA | 117.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.11 |
| LogP ≤ 5 | -4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|