About magnesium bis(2,2,2-trifluoroacetate)
magnesium bis(2,2,2-trifluoroacetate) (PubChem CID 11139550) has the molecular formula C4F6MgO4
and a molecular weight of 250.33 g/mol. Its IUPAC name is magnesium bis(2,2,2-trifluoroacetate).
Molecular Properties
| Compound Name | magnesium bis(2,2,2-trifluoroacetate) |
| PubChem CID | 11139550 |
| Molecular Formula | C4F6MgO4 |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 249.96 |
| IUPAC Name | magnesium bis(2,2,2-trifluoroacetate) |
| SMILES | O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F.[Mg+2] |
| InChI | InChI=1S/2C2HF3O2.Mg/c2*3-2(4,5)1(6)7;/h2*(H,6,7);/q;;+2/p-2 |
| InChIKey | WNBKPRWWMIPBSH-UHFFFAOYSA-L |
| XLogP | -1.78 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze magnesium bis(2,2,2-trifluoroacetate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium bis(2,2,2-trifluoroacetate)?
The IUPAC name of magnesium bis(2,2,2-trifluoroacetate) (CID 11139550) is magnesium bis(2,2,2-trifluoroacetate).
What is the SMILES notation for magnesium bis(2,2,2-trifluoroacetate)?
The canonical SMILES for magnesium bis(2,2,2-trifluoroacetate) is O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F.[Mg+2].
What is the InChIKey of magnesium bis(2,2,2-trifluoroacetate)?
The InChIKey is WNBKPRWWMIPBSH-UHFFFAOYSA-L. The full InChI is InChI=1S/2C2HF3O2.Mg/c2*3-2(4,5)1(6)7;/h2*(H,6,7);/q;;+2/p-2.
What are the key properties of magnesium bis(2,2,2-trifluoroacetate)?
magnesium bis(2,2,2-trifluoroacetate) has a molecular weight of 250.33 g/mol, XLogP of -1.78, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium bis(2,2,2-trifluoroacetate) is sourced from PubChem (CID 11139550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).