C4F6MgO4 — CID 11139550
magnesium bis(2,2,2-trifluoroacetate) (PubChem CID 11139550) has the molecular formula C4F6MgO4 and a molecular weight of 250.33 g/mol. Its IUPAC name is magnesium bis(2,2,2-trifluoroacetate).
| Compound Name | magnesium bis(2,2,2-trifluoroacetate) |
|---|---|
| PubChem CID | 11139550 |
| Molecular Formula | C4F6MgO4 |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 249.96 |
| IUPAC Name | magnesium bis(2,2,2-trifluoroacetate) |
| SMILES | O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F.[Mg+2] |
| InChI | InChI=1S/2C2HF3O2.Mg/c2*3-2(4,5)1(6)7;/h2*(H,6,7);/q;;+2/p-2 |
| InChIKey | WNBKPRWWMIPBSH-UHFFFAOYSA-L |
| XLogP | -1.78 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |