C2H3BF3LiO5 — CID 159468247
lithium;boric acid;2,2,2-trifluoroacetate (PubChem CID 159468247) has the molecular formula C2H3BF3LiO5 and a molecular weight of 181.79 g/mol. Its IUPAC name is lithium;boric acid;2,2,2-trifluoroacetate.
| Compound Name | lithium;boric acid;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 159468247 |
| Molecular Formula | C2H3BF3LiO5 |
| Molecular Weight | 181.79 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | lithium;boric acid;2,2,2-trifluoroacetate |
| SMILES | O=C([O-])C(F)(F)F.OB(O)O.[Li+] |
| InChI | InChI=1S/C2HF3O2.BH3O3.Li/c3-2(4,5)1(6)7;2-1(3)4;/h(H,6,7);2-4H;/q;;+1/p-1 |
| InChIKey | LVLSFWQSUTUIBP-UHFFFAOYSA-M |
| XLogP | -5.75 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.79 |
| LogP ≤ 5 | -5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|