C4H4F3LiO4 — CID 89314712
lithium;acetic acid;2,2,2-trifluoroacetate (PubChem CID 89314712) has the molecular formula C4H4F3LiO4 and a molecular weight of 180.01 g/mol. Its IUPAC name is lithium;acetic acid;2,2,2-trifluoroacetate.
| Compound Name | lithium;acetic acid;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 89314712 |
| Molecular Formula | C4H4F3LiO4 |
| Molecular Weight | 180.01 g/mol |
| Exact Mass | 180.02 |
| IUPAC Name | lithium;acetic acid;2,2,2-trifluoroacetate |
| SMILES | CC(=O)O.O=C([O-])C(F)(F)F.[Li+] |
| InChI | InChI=1S/C2HF3O2.C2H4O2.Li/c3-2(4,5)1(6)7;1-2(3)4;/h(H,6,7);1H3,(H,3,4);/q;;+1/p-1 |
| InChIKey | MTBKWNZWNQFWKL-UHFFFAOYSA-M |
| XLogP | -3.61 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.01 |
| LogP ≤ 5 | -3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |