C8F14KNO2 — CID 3767193
potassium 2-[difluoro-(2,2,3,3,4,4,5,5-octafluoropyrrolidin-1-yl)methyl]-2,3,3,3-tetrafluoropropanoate (PubChem CID 3767193) has the molecular formula C8F14KNO2 and a molecular weight of 447.16 g/mol. Its IUPAC name is potassium 2-[difluoro-(2,2,3,3,4,4,5,5-octafluoropyrrolidin-1-yl)methyl]-2,3,3,3-tetrafluoropropanoate.
| Compound Name | potassium 2-[difluoro-(2,2,3,3,4,4,5,5-octafluoropyrrolidin-1-yl)methyl]-2,3,3,3-tetrafluoropropanoate |
|---|---|
| PubChem CID | 3767193 |
| Molecular Formula | C8F14KNO2 |
| Molecular Weight | 447.16 g/mol |
| Exact Mass | 446.93 |
| IUPAC Name | potassium 2-[difluoro-(2,2,3,3,4,4,5,5-octafluoropyrrolidin-1-yl)methyl]-2,3,3,3-tetrafluoropropanoate |
| SMILES | O=C([O-])C(F)(C(F)(F)F)C(F)(F)N1C(F)(F)C(F)(F)C(F)(F)C1(F)F.[K+] |
| InChI | InChI=1S/C8HF14NO2.K/c9-2(1(24)25,5(14,15)16)6(17,18)23-7(19,20)3(10,11)4(12,13)8(23,21)22;/h(H,24,25);/q;+1/p-1 |
| InChIKey | URDTXFSUEZUBDH-UHFFFAOYSA-M |
| XLogP | -0.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.16 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|