C9F17NO — CID 14249747
2-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroazepan-1-yl)-2,3,3,3-tetrafluoropropanoyl fluoride (PubChem CID 14249747) has the molecular formula C9F17NO and a molecular weight of 461.07 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroazepan-1-yl)-2,3,3,3-tetrafluoropropanoyl fluoride.
| Compound Name | 2-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroazepan-1-yl)-2,3,3,3-tetrafluoropropanoyl fluoride |
|---|---|
| PubChem CID | 14249747 |
| Molecular Formula | C9F17NO |
| Molecular Weight | 461.07 g/mol |
| Exact Mass | 460.97 |
| IUPAC Name | 2-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroazepan-1-yl)-2,3,3,3-tetrafluoropropanoyl fluoride |
| SMILES | O=C(F)C(F)(N1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F)C(F)(F)F |
| InChI | InChI=1S/C9F17NO/c10-1(28)2(11,7(20,21)22)27-8(23,24)5(16,17)3(12,13)4(14,15)6(18,19)9(27,25)26 |
| InChIKey | PYSRQBYLKZHDCM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.07 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|