C15H11F16N2NaO3 — CID 130238272
sodium 6-[[2-[(2,2,3,3,4,4,5,5,6,6-decafluoropiperidin-1-yl)-difluoromethyl]-2,3,3,3-tetrafluoropropanoyl]amino]hexanoate (PubChem CID 130238272) has the molecular formula C15H11F16N2NaO3 and a molecular weight of 594.22 g/mol. Its IUPAC name is sodium 6-[[2-[(2,2,3,3,4,4,5,5,6,6-decafluoropiperidin-1-yl)-difluoromethyl]-2,3,3,3-tetrafluoropropanoyl]amino]hexanoate.
| Compound Name | sodium 6-[[2-[(2,2,3,3,4,4,5,5,6,6-decafluoropiperidin-1-yl)-difluoromethyl]-2,3,3,3-tetrafluoropropanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 130238272 |
| Molecular Formula | C15H11F16N2NaO3 |
| Molecular Weight | 594.22 g/mol |
| Exact Mass | 594.04 |
| IUPAC Name | sodium 6-[[2-[(2,2,3,3,4,4,5,5,6,6-decafluoropiperidin-1-yl)-difluoromethyl]-2,3,3,3-tetrafluoropropanoyl]amino]hexanoate |
| SMILES | O=C([O-])CCCCCNC(=O)C(F)(C(F)(F)F)C(F)(F)N1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F.[Na+] |
| InChI | InChI=1S/C15H12F16N2O3.Na/c16-8(12(23,24)25,7(36)32-5-3-1-2-4-6(34)35)13(26,27)33-14(28,29)10(19,20)9(17,18)11(21,22)15(33,30)31;/h1-5H2,(H,32,36)(H,34,35);/q;+1/p-1 |
| InChIKey | DWQASHXGCIZYOZ-UHFFFAOYSA-M |
| XLogP | 0.69 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|