C9HF16NNaO2 — CID 126957410
Sodium 3-(2,2,3,3,4,4,5,5,6,6-decafluoro-1-piperidinyl)-2,3,3-trifluoro-2-(trifluoromethyl)propanoate (PubChem CID 126957410) has the molecular formula C9HF16NNaO2 and a molecular weight of 482.07 g/mol.
| Compound Name | Sodium 3-(2,2,3,3,4,4,5,5,6,6-decafluoro-1-piperidinyl)-2,3,3-trifluoro-2-(trifluoromethyl)propanoate |
|---|---|
| PubChem CID | 126957410 |
| Molecular Formula | C9HF16NNaO2 |
| Molecular Weight | 482.07 g/mol |
| Exact Mass | 481.96 |
| IUPAC Name | — |
| SMILES | O=C(O)C(F)(C(F)(F)F)C(F)(F)N1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F.[Na] |
| InChI | InChI=1S/C9HF16NO2.Na/c10-2(1(27)28,6(17,18)19)7(20,21)26-8(22,23)4(13,14)3(11,12)5(15,16)9(26,24)25;/h(H,27,28); |
| InChIKey | MDPYEEFZYXJSRW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.07 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|