C7F12KNO2 — CID 5235810
potassium 2,3,3,3-tetrafluoro-2-(2,2,3,3,4,4,5,5-octafluoropyrrolidin-1-yl)propanoate (PubChem CID 5235810) has the molecular formula C7F12KNO2 and a molecular weight of 397.16 g/mol. Its IUPAC name is potassium 2,3,3,3-tetrafluoro-2-(2,2,3,3,4,4,5,5-octafluoropyrrolidin-1-yl)propanoate.
| Compound Name | potassium 2,3,3,3-tetrafluoro-2-(2,2,3,3,4,4,5,5-octafluoropyrrolidin-1-yl)propanoate |
|---|---|
| PubChem CID | 5235810 |
| Molecular Formula | C7F12KNO2 |
| Molecular Weight | 397.16 g/mol |
| Exact Mass | 396.94 |
| IUPAC Name | potassium 2,3,3,3-tetrafluoro-2-(2,2,3,3,4,4,5,5-octafluoropyrrolidin-1-yl)propanoate |
| SMILES | O=C([O-])C(F)(N1C(F)(F)C(F)(F)C(F)(F)C1(F)F)C(F)(F)F.[K+] |
| InChI | InChI=1S/C7HF12NO2.K/c8-2(1(21)22,5(13,14)15)20-6(16,17)3(9,10)4(11,12)7(20,18)19;/h(H,21,22);/q;+1/p-1 |
| InChIKey | CTZFJFXRFCRSSJ-UHFFFAOYSA-M |
| XLogP | -1.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.16 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|