C7HF12NO2 — CID 98130159
(2S)-2,3,3,3-tetrafluoro-2-(2,2,3,3,4,4,5,5-octafluoropyrrolidin-1-yl)propanoic acid (PubChem CID 98130159) has the molecular formula C7HF12NO2 and a molecular weight of 359.07 g/mol. Its IUPAC name is (2S)-2,3,3,3-tetrafluoro-2-(2,2,3,3,4,4,5,5-octafluoropyrrolidin-1-yl)propanoic acid.
| Compound Name | (2S)-2,3,3,3-tetrafluoro-2-(2,2,3,3,4,4,5,5-octafluoropyrrolidin-1-yl)propanoic acid |
|---|---|
| PubChem CID | 98130159 |
| Molecular Formula | C7HF12NO2 |
| Molecular Weight | 359.07 g/mol |
| Exact Mass | 358.98 |
| IUPAC Name | (2S)-2,3,3,3-tetrafluoro-2-(2,2,3,3,4,4,5,5-octafluoropyrrolidin-1-yl)propanoic acid |
| SMILES | O=C(O)[C@@](F)(N1C(F)(F)C(F)(F)C(F)(F)C1(F)F)C(F)(F)F |
| InChI | InChI=1S/C7HF12NO2/c8-2(1(21)22,5(13,14)15)20-6(16,17)3(9,10)4(11,12)7(20,18)19/h(H,21,22)/t2-/m1/s1 |
| InChIKey | UEMCEVFIBUIDFT-UWTATZPHSA-N |
| XLogP | 3.07 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.07 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|