C8HF14NO2 — CID 88649885
3,3,3-trifluoro-2-(2,2,3,3,4,4,5,5-octafluoropyrrolidin-1-yl)-2-(trifluoromethyl)propanoic acid (PubChem CID 88649885) has the molecular formula C8HF14NO2 and a molecular weight of 409.07 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(2,2,3,3,4,4,5,5-octafluoropyrrolidin-1-yl)-2-(trifluoromethyl)propanoic acid.
| Compound Name | 3,3,3-trifluoro-2-(2,2,3,3,4,4,5,5-octafluoropyrrolidin-1-yl)-2-(trifluoromethyl)propanoic acid |
|---|---|
| PubChem CID | 88649885 |
| Molecular Formula | C8HF14NO2 |
| Molecular Weight | 409.07 g/mol |
| Exact Mass | 408.98 |
| IUPAC Name | 3,3,3-trifluoro-2-(2,2,3,3,4,4,5,5-octafluoropyrrolidin-1-yl)-2-(trifluoromethyl)propanoic acid |
| SMILES | O=C(O)C(N1C(F)(F)C(F)(F)C(F)(F)C1(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8HF14NO2/c9-3(10)4(11,12)8(21,22)23(7(3,19)20)2(1(24)25,5(13,14)15)6(16,17)18/h(H,24,25) |
| InChIKey | IRALJUDAKKIPMS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.07 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|