C15H5F16N2NaO4S — CID 129185121
sodium 4-[[2-[(2,2,3,3,4,4,5,5,6,6-decafluoropiperidin-1-yl)-difluoromethyl]-2,3,3,3-tetrafluoropropanoyl]amino]benzenesulfonate (PubChem CID 129185121) has the molecular formula C15H5F16N2NaO4S and a molecular weight of 636.24 g/mol. Its IUPAC name is sodium 4-[[2-[(2,2,3,3,4,4,5,5,6,6-decafluoropiperidin-1-yl)-difluoromethyl]-2,3,3,3-tetrafluoropropanoyl]amino]benzenesulfonate.
| Compound Name | sodium 4-[[2-[(2,2,3,3,4,4,5,5,6,6-decafluoropiperidin-1-yl)-difluoromethyl]-2,3,3,3-tetrafluoropropanoyl]amino]benzenesulfonate |
|---|---|
| PubChem CID | 129185121 |
| Molecular Formula | C15H5F16N2NaO4S |
| Molecular Weight | 636.24 g/mol |
| Exact Mass | 635.96 |
| IUPAC Name | sodium 4-[[2-[(2,2,3,3,4,4,5,5,6,6-decafluoropiperidin-1-yl)-difluoromethyl]-2,3,3,3-tetrafluoropropanoyl]amino]benzenesulfonate |
| SMILES | O=C(Nc1ccc(S(=O)(=O)[O-])cc1)C(F)(C(F)(F)F)C(F)(F)N1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F.[Na+] |
| InChI | InChI=1S/C15H6F16N2O4S.Na/c16-8(12(23,24)25,7(34)32-5-1-3-6(4-2-5)38(35,36)37)13(26,27)33-14(28,29)10(19,20)9(17,18)11(21,22)15(33,30)31;/h1-4H,(H,32,34)(H,35,36,37);/q;+1/p-1 |
| InChIKey | MZEZMPVKXGJTSK-UHFFFAOYSA-M |
| XLogP | 1.80 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|