C12H6F10N2O3 — CID 3320173
2,2-difluoro-N-(4-hydroxyphenyl)-2-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)acetamide (PubChem CID 3320173) has the molecular formula C12H6F10N2O3 and a molecular weight of 416.17 g/mol. Its IUPAC name is 2,2-difluoro-N-(4-hydroxyphenyl)-2-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)acetamide.
| Compound Name | 2,2-difluoro-N-(4-hydroxyphenyl)-2-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)acetamide |
|---|---|
| PubChem CID | 3320173 |
| Molecular Formula | C12H6F10N2O3 |
| Molecular Weight | 416.17 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | 2,2-difluoro-N-(4-hydroxyphenyl)-2-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)acetamide |
| SMILES | O=C(Nc1ccc(O)cc1)C(F)(F)N1C(F)(F)C(F)(F)OC(F)(F)C1(F)F |
| InChI | InChI=1S/C12H6F10N2O3/c13-8(14,7(26)23-5-1-3-6(25)4-2-5)24-9(15,16)11(19,20)27-12(21,22)10(24,17)18/h1-4,25H,(H,23,26) |
| InChIKey | WFXSPTAOTYGKIN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.17 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|