C20H10F14N2O3 — CID 124631816
2,2-difluoro-2-[(2R,6R)-2,3,3,5,5,6-hexafluoro-2,6-bis(trifluoromethyl)morpholin-4-yl]-N-(4-phenoxyphenyl)acetamide (PubChem CID 124631816) has the molecular formula C20H10F14N2O3 and a molecular weight of 592.28 g/mol. Its IUPAC name is 2,2-difluoro-2-[(2R,6R)-2,3,3,5,5,6-hexafluoro-2,6-bis(trifluoromethyl)morpholin-4-yl]-N-(4-phenoxyphenyl)acetamide.
| Compound Name | 2,2-difluoro-2-[(2R,6R)-2,3,3,5,5,6-hexafluoro-2,6-bis(trifluoromethyl)morpholin-4-yl]-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 124631816 |
| Molecular Formula | C20H10F14N2O3 |
| Molecular Weight | 592.28 g/mol |
| Exact Mass | 592.05 |
| IUPAC Name | 2,2-difluoro-2-[(2R,6R)-2,3,3,5,5,6-hexafluoro-2,6-bis(trifluoromethyl)morpholin-4-yl]-N-(4-phenoxyphenyl)acetamide |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)cc1)C(F)(F)N1C(F)(F)[C@@](F)(C(F)(F)F)O[C@](F)(C(F)(F)F)C1(F)F |
| InChI | InChI=1S/C20H10F14N2O3/c21-14(22,13(37)35-10-6-8-12(9-7-10)38-11-4-2-1-3-5-11)36-19(31,32)15(23,17(25,26)27)39-16(24,18(28,29)30)20(36,33)34/h1-9H,(H,35,37)/t15-,16-/m1/s1 |
| InChIKey | VWRYGZVLKQUPFI-HZPDHXFCSA-N |
| XLogP | 6.98 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.28 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|