C7F12KNO3 — CID 4220247
potassium 2,2,3,3-tetrafluoro-3-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)propanoate (PubChem CID 4220247) has the molecular formula C7F12KNO3 and a molecular weight of 413.16 g/mol. Its IUPAC name is potassium 2,2,3,3-tetrafluoro-3-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)propanoate.
| Compound Name | potassium 2,2,3,3-tetrafluoro-3-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)propanoate |
|---|---|
| PubChem CID | 4220247 |
| Molecular Formula | C7F12KNO3 |
| Molecular Weight | 413.16 g/mol |
| Exact Mass | 412.93 |
| IUPAC Name | potassium 2,2,3,3-tetrafluoro-3-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)propanoate |
| SMILES | O=C([O-])C(F)(F)C(F)(F)N1C(F)(F)C(F)(F)OC(F)(F)C1(F)F.[K+] |
| InChI | InChI=1S/C7HF12NO3.K/c8-2(9,1(21)22)3(10,11)20-4(12,13)6(16,17)23-7(18,19)5(20,14)15;/h(H,21,22);/q;+1/p-1 |
| InChIKey | QKURHTKJHUSSJB-UHFFFAOYSA-M |
| XLogP | -1.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.16 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|