C7F15NO — CID 14172428
2,2,3,3,5,5,6,6-octafluoro-4-(1,1,2,2,3,3,3-heptafluoropropyl)morpholine (PubChem CID 14172428) has the molecular formula C7F15NO and a molecular weight of 399.05 g/mol. Its IUPAC name is 2,2,3,3,5,5,6,6-octafluoro-4-(1,1,2,2,3,3,3-heptafluoropropyl)morpholine.
| Compound Name | 2,2,3,3,5,5,6,6-octafluoro-4-(1,1,2,2,3,3,3-heptafluoropropyl)morpholine |
|---|---|
| PubChem CID | 14172428 |
| Molecular Formula | C7F15NO |
| Molecular Weight | 399.05 g/mol |
| Exact Mass | 398.97 |
| IUPAC Name | 2,2,3,3,5,5,6,6-octafluoro-4-(1,1,2,2,3,3,3-heptafluoropropyl)morpholine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)N1C(F)(F)C(F)(F)OC(F)(F)C1(F)F |
| InChI | InChI=1S/C7F15NO/c8-1(9,2(10,11)12)3(13,14)23-4(15,16)6(19,20)24-7(21,22)5(23,17)18 |
| InChIKey | JSCNNFNZCLWGRW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.05 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|