C8H4F11NO — CID 134518820
2,2,3,3,5,5,6,6-octafluoro-4-(1,2,2-trifluorobut-3-enyl)morpholine (PubChem CID 134518820) has the molecular formula C8H4F11NO and a molecular weight of 339.10 g/mol. Its IUPAC name is 2,2,3,3,5,5,6,6-octafluoro-4-(1,2,2-trifluorobut-3-enyl)morpholine.
| Compound Name | 2,2,3,3,5,5,6,6-octafluoro-4-(1,2,2-trifluorobut-3-enyl)morpholine |
|---|---|
| PubChem CID | 134518820 |
| Molecular Formula | C8H4F11NO |
| Molecular Weight | 339.10 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 2,2,3,3,5,5,6,6-octafluoro-4-(1,2,2-trifluorobut-3-enyl)morpholine |
| SMILES | C=CC(F)(F)C(F)N1C(F)(F)C(F)(F)OC(F)(F)C1(F)F |
| InChI | InChI=1S/C8H4F11NO/c1-2-4(10,11)3(9)20-5(12,13)7(16,17)21-8(18,19)6(20,14)15/h2-3H,1H2 |
| InChIKey | UPKASPYZUJACGE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.10 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|