C8H4F11NO2 — CID 158360632
2,2,3,3,5,5,6,6-octafluoro-4-(3,3,3-trifluoro-2-methoxyprop-1-enyl)morpholine (PubChem CID 158360632) has the molecular formula C8H4F11NO2 and a molecular weight of 355.10 g/mol. Its IUPAC name is 2,2,3,3,5,5,6,6-octafluoro-4-(3,3,3-trifluoro-2-methoxyprop-1-enyl)morpholine.
| Compound Name | 2,2,3,3,5,5,6,6-octafluoro-4-(3,3,3-trifluoro-2-methoxyprop-1-enyl)morpholine |
|---|---|
| PubChem CID | 158360632 |
| Molecular Formula | C8H4F11NO2 |
| Molecular Weight | 355.10 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | 2,2,3,3,5,5,6,6-octafluoro-4-(3,3,3-trifluoro-2-methoxyprop-1-enyl)morpholine |
| SMILES | COC(=CN1C(F)(F)C(F)(F)OC(F)(F)C1(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H4F11NO2/c1-21-3(4(9,10)11)2-20-5(12,13)7(16,17)22-8(18,19)6(20,14)15/h2H,1H3 |
| InChIKey | GTKRQPZAMLCXRJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.10 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|