C6HF10NO — CID 166464833
4-(2,2-difluoroethenyl)-2,2,3,3,5,5,6,6-octafluoromorpholine (PubChem CID 166464833) has the molecular formula C6HF10NO and a molecular weight of 293.06 g/mol. Its IUPAC name is 4-(2,2-difluoroethenyl)-2,2,3,3,5,5,6,6-octafluoromorpholine.
| Compound Name | 4-(2,2-difluoroethenyl)-2,2,3,3,5,5,6,6-octafluoromorpholine |
|---|---|
| PubChem CID | 166464833 |
| Molecular Formula | C6HF10NO |
| Molecular Weight | 293.06 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | 4-(2,2-difluoroethenyl)-2,2,3,3,5,5,6,6-octafluoromorpholine |
| SMILES | FC(F)=CN1C(F)(F)C(F)(F)OC(F)(F)C1(F)F |
| InChI | InChI=1S/C6HF10NO/c7-2(8)1-17-3(9,10)5(13,14)18-6(15,16)4(17,11)12/h1H |
| InChIKey | FPRRVBCNEHSEHP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.06 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|