C7F9NO2 — CID 139785161
3-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)prop-2-ynoyl fluoride (PubChem CID 139785161) has the molecular formula C7F9NO2 and a molecular weight of 301.06 g/mol. Its IUPAC name is 3-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)prop-2-ynoyl fluoride.
| Compound Name | 3-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)prop-2-ynoyl fluoride |
|---|---|
| PubChem CID | 139785161 |
| Molecular Formula | C7F9NO2 |
| Molecular Weight | 301.06 g/mol |
| Exact Mass | 300.98 |
| IUPAC Name | 3-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)prop-2-ynoyl fluoride |
| SMILES | O=C(F)C#CN1C(F)(F)C(F)(F)OC(F)(F)C1(F)F |
| InChI | InChI=1S/C7F9NO2/c8-3(18)1-2-17-4(9,10)6(13,14)19-7(15,16)5(17,11)12 |
| InChIKey | YZKOOYUHHIUCPW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.06 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|