C9H2F15NO — CID 166464827
2,2,3,3,5,5,6,6-octafluoro-4-(2,3,3,4,4,5,5-heptafluoropent-1-enyl)morpholine (PubChem CID 166464827) has the molecular formula C9H2F15NO and a molecular weight of 425.09 g/mol. Its IUPAC name is 2,2,3,3,5,5,6,6-octafluoro-4-(2,3,3,4,4,5,5-heptafluoropent-1-enyl)morpholine.
| Compound Name | 2,2,3,3,5,5,6,6-octafluoro-4-(2,3,3,4,4,5,5-heptafluoropent-1-enyl)morpholine |
|---|---|
| PubChem CID | 166464827 |
| Molecular Formula | C9H2F15NO |
| Molecular Weight | 425.09 g/mol |
| Exact Mass | 424.99 |
| IUPAC Name | 2,2,3,3,5,5,6,6-octafluoro-4-(2,3,3,4,4,5,5-heptafluoropent-1-enyl)morpholine |
| SMILES | FC(=CN1C(F)(F)C(F)(F)OC(F)(F)C1(F)F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H2F15NO/c10-2(4(13,14)5(15,16)3(11)12)1-25-6(17,18)8(21,22)26-9(23,24)7(25,19)20/h1,3H |
| InChIKey | FELKCXVJBAAPPH-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.09 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|