C8H4F14N2O3 — CID 129185151
azanium 2,2,3,4,4,4-hexafluoro-3-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)butanoate (PubChem CID 129185151) has the molecular formula C8H4F14N2O3 and a molecular weight of 442.10 g/mol. Its IUPAC name is azanium 2,2,3,4,4,4-hexafluoro-3-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)butanoate.
| Compound Name | azanium 2,2,3,4,4,4-hexafluoro-3-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)butanoate |
|---|---|
| PubChem CID | 129185151 |
| Molecular Formula | C8H4F14N2O3 |
| Molecular Weight | 442.10 g/mol |
| Exact Mass | 442.00 |
| IUPAC Name | azanium 2,2,3,4,4,4-hexafluoro-3-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)butanoate |
| SMILES | O=C([O-])C(F)(F)C(F)(N1C(F)(F)C(F)(F)OC(F)(F)C1(F)F)C(F)(F)F.[NH4+] |
| InChI | InChI=1S/C8HF14NO3.H3N/c9-2(10,1(24)25)3(11,4(12,13)14)23-5(15,16)7(19,20)26-8(21,22)6(23,17)18;/h(H,24,25);1H3 |
| InChIKey | MOBZPZZHSGHBBZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.10 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|