C10H8F10INO3 — CID 172773938
4-iodobutyl 2,2-difluoro-2-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)acetate (PubChem CID 172773938) has the molecular formula C10H8F10INO3 and a molecular weight of 507.06 g/mol. Its IUPAC name is 4-iodobutyl 2,2-difluoro-2-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)acetate.
| Compound Name | 4-iodobutyl 2,2-difluoro-2-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)acetate |
|---|---|
| PubChem CID | 172773938 |
| Molecular Formula | C10H8F10INO3 |
| Molecular Weight | 507.06 g/mol |
| Exact Mass | 506.94 |
| IUPAC Name | 4-iodobutyl 2,2-difluoro-2-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)acetate |
| SMILES | O=C(OCCCCI)C(F)(F)N1C(F)(F)C(F)(F)OC(F)(F)C1(F)F |
| InChI | InChI=1S/C10H8F10INO3/c11-6(12,5(23)24-4-2-1-3-21)22-7(13,14)9(17,18)25-10(19,20)8(22,15)16/h1-4H2 |
| InChIKey | NIGYJTUXGIQJJN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.06 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|