About 3-iodopropyl 4-[3-(trifluoromethyl)diazirin-3-yl]benzoate
3-iodopropyl 4-[3-(trifluoromethyl)diazirin-3-yl]benzoate (PubChem CID 118953432) has the molecular formula C12H10F3IN2O2
and a molecular weight of 398.12 g/mol. Its IUPAC name is 3-iodopropyl 4-[3-(trifluoromethyl)diazirin-3-yl]benzoate.
Molecular Properties
| Compound Name | 3-iodopropyl 4-[3-(trifluoromethyl)diazirin-3-yl]benzoate |
| PubChem CID | 118953432 |
| Molecular Formula | C12H10F3IN2O2 |
| Molecular Weight | 398.12 g/mol |
| Exact Mass | 397.97 |
| IUPAC Name | 3-iodopropyl 4-[3-(trifluoromethyl)diazirin-3-yl]benzoate |
| SMILES | O=C(OCCCI)c1ccc(C2(C(F)(F)F)N=N2)cc1 |
| InChI | InChI=1S/C12H10F3IN2O2/c13-12(14,15)11(17-18-11)9-4-2-8(3-5-9)10(19)20-7-1-6-16/h2-5H,1,6-7H2 |
| InChIKey | WIEHZDQRCILWGY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.12 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodopropyl 4-[3-(trifluoromethyl)diazirin-3-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodopropyl 4-[3-(trifluoromethyl)diazirin-3-yl]benzoate?
The IUPAC name of 3-iodopropyl 4-[3-(trifluoromethyl)diazirin-3-yl]benzoate (CID 118953432) is 3-iodopropyl 4-[3-(trifluoromethyl)diazirin-3-yl]benzoate.
What is the SMILES notation for 3-iodopropyl 4-[3-(trifluoromethyl)diazirin-3-yl]benzoate?
The canonical SMILES for 3-iodopropyl 4-[3-(trifluoromethyl)diazirin-3-yl]benzoate is O=C(OCCCI)c1ccc(C2(C(F)(F)F)N=N2)cc1.
What is the InChIKey of 3-iodopropyl 4-[3-(trifluoromethyl)diazirin-3-yl]benzoate?
The InChIKey is WIEHZDQRCILWGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F3IN2O2/c13-12(14,15)11(17-18-11)9-4-2-8(3-5-9)10(19)20-7-1-6-16/h2-5H,1,6-7H2.
What are the key properties of 3-iodopropyl 4-[3-(trifluoromethyl)diazirin-3-yl]benzoate?
3-iodopropyl 4-[3-(trifluoromethyl)diazirin-3-yl]benzoate has a molecular weight of 398.12 g/mol, XLogP of 3.85, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodopropyl 4-[3-(trifluoromethyl)diazirin-3-yl]benzoate is sourced from PubChem (CID 118953432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).