C16H22Cl4O4Si2 — CID 101081557
bis[3-[dichloro(methyl)silyl]propyl] benzene-1,4-dicarboxylate (PubChem CID 101081557) has the molecular formula C16H22Cl4O4Si2 and a molecular weight of 476.33 g/mol. Its IUPAC name is bis[3-[dichloro(methyl)silyl]propyl] benzene-1,4-dicarboxylate.
| Compound Name | bis[3-[dichloro(methyl)silyl]propyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 101081557 |
| Molecular Formula | C16H22Cl4O4Si2 |
| Molecular Weight | 476.33 g/mol |
| Exact Mass | 473.98 |
| IUPAC Name | bis[3-[dichloro(methyl)silyl]propyl] benzene-1,4-dicarboxylate |
| SMILES | C[Si](Cl)(Cl)CCCOC(=O)c1ccc(C(=O)OCCC[Si](C)(Cl)Cl)cc1 |
| InChI | InChI=1S/C16H22Cl4O4Si2/c1-25(17,18)11-3-9-23-15(21)13-5-7-14(8-6-13)16(22)24-10-4-12-26(2,19)20/h5-8H,3-4,9-12H2,1-2H3 |
| InChIKey | FZDAUCXFWNTCPZ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.33 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|