About 3-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]propyl 4-aminobenzoate
3-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]propyl 4-aminobenzoate (PubChem CID 70022386) has the molecular formula C20H39NO5Si3
and a molecular weight of 457.79 g/mol. Its IUPAC name is 3-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]propyl 4-aminobenzoate.
Molecular Properties
| Compound Name | 3-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]propyl 4-aminobenzoate |
| PubChem CID | 70022386 |
| Molecular Formula | C20H39NO5Si3 |
| Molecular Weight | 457.79 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 3-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]propyl 4-aminobenzoate |
| SMILES | C[Si](C)(C)O[Si](C)(CCCOCCCOC(=O)c1ccc(N)cc1)O[Si](C)(C)C |
| InChI | InChI=1S/C20H39NO5Si3/c1-27(2,3)25-29(7,26-28(4,5)6)17-9-15-23-14-8-16-24-20(22)18-10-12-19(21)13-11-18/h10-13H,8-9,14-17,21H2,1-7H3 |
| InChIKey | WDROEKOODBRXCT-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.79 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]propyl 4-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]propyl 4-aminobenzoate?
The IUPAC name of 3-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]propyl 4-aminobenzoate (CID 70022386) is 3-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]propyl 4-aminobenzoate.
What is the SMILES notation for 3-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]propyl 4-aminobenzoate?
The canonical SMILES for 3-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]propyl 4-aminobenzoate is C[Si](C)(C)O[Si](C)(CCCOCCCOC(=O)c1ccc(N)cc1)O[Si](C)(C)C.
What is the InChIKey of 3-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]propyl 4-aminobenzoate?
The InChIKey is WDROEKOODBRXCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H39NO5Si3/c1-27(2,3)25-29(7,26-28(4,5)6)17-9-15-23-14-8-16-24-20(22)18-10-12-19(21)13-11-18/h10-13H,8-9,14-17,21H2,1-7H3.
What are the key properties of 3-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]propyl 4-aminobenzoate?
3-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]propyl 4-aminobenzoate has a molecular weight of 457.79 g/mol, XLogP of 5.00, 13 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]propyl 4-aminobenzoate is sourced from PubChem (CID 70022386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).