C20H34O6Si2 — CID 11502797
bis(3-trimethylsilyloxypropyl) benzene-1,4-dicarboxylate (PubChem CID 11502797) has the molecular formula C20H34O6Si2 and a molecular weight of 426.66 g/mol. Its IUPAC name is bis(3-trimethylsilyloxypropyl) benzene-1,4-dicarboxylate.
| Compound Name | bis(3-trimethylsilyloxypropyl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 11502797 |
| Molecular Formula | C20H34O6Si2 |
| Molecular Weight | 426.66 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | bis(3-trimethylsilyloxypropyl) benzene-1,4-dicarboxylate |
| SMILES | C[Si](C)(C)OCCCOC(=O)c1ccc(C(=O)OCCCO[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C20H34O6Si2/c1-27(2,3)25-15-7-13-23-19(21)17-9-11-18(12-10-17)20(22)24-14-8-16-26-28(4,5)6/h9-12H,7-8,13-16H2,1-6H3 |
| InChIKey | DRPSDGSJGWOYTO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.66 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|