C17H42O6Si3 — CID 59760729
3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propyl-methyl-bis(trimethylsilyloxy)silane (PubChem CID 59760729) has the molecular formula C17H42O6Si3 and a molecular weight of 426.78 g/mol. Its IUPAC name is 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propyl-methyl-bis(trimethylsilyloxy)silane.
| Compound Name | 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propyl-methyl-bis(trimethylsilyloxy)silane |
|---|---|
| PubChem CID | 59760729 |
| Molecular Formula | C17H42O6Si3 |
| Molecular Weight | 426.78 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propyl-methyl-bis(trimethylsilyloxy)silane |
| SMILES | COCCOCCOCCOCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C17H42O6Si3/c1-18-11-12-20-15-16-21-14-13-19-10-9-17-26(8,22-24(2,3)4)23-25(5,6)7/h9-17H2,1-8H3 |
| InChIKey | VCWGPUFOXDGJEB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.78 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|