C19H46O8Si3 — CID 58479003
3-[1-methoxy-3-[2-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]ethoxy]propan-2-yl]oxypropane-1,2-diol (PubChem CID 58479003) has the molecular formula C19H46O8Si3 and a molecular weight of 486.83 g/mol. Its IUPAC name is 3-[1-methoxy-3-[2-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]ethoxy]propan-2-yl]oxypropane-1,2-diol.
| Compound Name | 3-[1-methoxy-3-[2-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]ethoxy]propan-2-yl]oxypropane-1,2-diol |
|---|---|
| PubChem CID | 58479003 |
| Molecular Formula | C19H46O8Si3 |
| Molecular Weight | 486.83 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 3-[1-methoxy-3-[2-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]ethoxy]propan-2-yl]oxypropane-1,2-diol |
| SMILES | COCC(COCCOCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)OCC(O)CO |
| InChI | InChI=1S/C19H46O8Si3/c1-22-16-19(25-15-18(21)14-20)17-24-12-11-23-10-9-13-30(8,26-28(2,3)4)27-29(5,6)7/h18-21H,9-17H2,1-8H3 |
| InChIKey | RMUKRSWFHRZVQL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.83 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|