C13H36O3Si2 — CID 160993525
methane;3-(2-methoxyethoxy)propyl-dimethyl-trimethylsilyloxysilane (PubChem CID 160993525) has the molecular formula C13H36O3Si2 and a molecular weight of 296.60 g/mol. Its IUPAC name is methane;3-(2-methoxyethoxy)propyl-dimethyl-trimethylsilyloxysilane.
| Compound Name | methane;3-(2-methoxyethoxy)propyl-dimethyl-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 160993525 |
| Molecular Formula | C13H36O3Si2 |
| Molecular Weight | 296.60 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | methane;3-(2-methoxyethoxy)propyl-dimethyl-trimethylsilyloxysilane |
| SMILES | C.C.COCCOCCC[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C11H28O3Si2.2CH4/c1-12-9-10-13-8-7-11-16(5,6)14-15(2,3)4;;/h7-11H2,1-6H3;2*1H4 |
| InChIKey | TUYCILKAWVLUOT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.60 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|