C20H46O5S2Si2 — CID 169283673
3-[2-(2-methoxyethoxy)ethylsulfanyl]propyl-[3-[2-(2-methoxyethoxy)ethylsulfanyl]propyl-dimethylsilyl]oxy-dimethylsilane (PubChem CID 169283673) has the molecular formula C20H46O5S2Si2 and a molecular weight of 486.89 g/mol. Its IUPAC name is 3-[2-(2-methoxyethoxy)ethylsulfanyl]propyl-[3-[2-(2-methoxyethoxy)ethylsulfanyl]propyl-dimethylsilyl]oxy-dimethylsilane.
| Compound Name | 3-[2-(2-methoxyethoxy)ethylsulfanyl]propyl-[3-[2-(2-methoxyethoxy)ethylsulfanyl]propyl-dimethylsilyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 169283673 |
| Molecular Formula | C20H46O5S2Si2 |
| Molecular Weight | 486.89 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | 3-[2-(2-methoxyethoxy)ethylsulfanyl]propyl-[3-[2-(2-methoxyethoxy)ethylsulfanyl]propyl-dimethylsilyl]oxy-dimethylsilane |
| SMILES | COCCOCCSCCC[Si](C)(C)O[Si](C)(C)CCCSCCOCCOC |
| InChI | InChI=1S/C20H46O5S2Si2/c1-21-9-11-23-13-17-26-15-7-19-28(3,4)25-29(5,6)20-8-16-27-18-14-24-12-10-22-2/h7-20H2,1-6H3 |
| InChIKey | MLOUPTGIHNIBIP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.89 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|