C13H30O5SSi — CID 58816829
dimethoxy-[3-[2-[2-(2-methoxyethoxy)ethoxy]ethylsulfanyl]propyl]-methylsilane (PubChem CID 58816829) has the molecular formula C13H30O5SSi and a molecular weight of 326.53 g/mol. Its IUPAC name is dimethoxy-[3-[2-[2-(2-methoxyethoxy)ethoxy]ethylsulfanyl]propyl]-methylsilane.
| Compound Name | dimethoxy-[3-[2-[2-(2-methoxyethoxy)ethoxy]ethylsulfanyl]propyl]-methylsilane |
|---|---|
| PubChem CID | 58816829 |
| Molecular Formula | C13H30O5SSi |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | dimethoxy-[3-[2-[2-(2-methoxyethoxy)ethoxy]ethylsulfanyl]propyl]-methylsilane |
| SMILES | COCCOCCOCCSCCC[Si](C)(OC)OC |
| InChI | InChI=1S/C13H30O5SSi/c1-14-6-7-17-8-9-18-10-12-19-11-5-13-20(4,15-2)16-3/h5-13H2,1-4H3 |
| InChIKey | YZQODCJIYZTEAO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|