C16H38O5Si2 — CID 58607575
3-(2-methoxyethoxy)propyl-[3-(2-methoxyethoxy)propyl-dimethylsilyl]oxy-dimethylsilane (PubChem CID 58607575) has the molecular formula C16H38O5Si2 and a molecular weight of 366.65 g/mol. Its IUPAC name is 3-(2-methoxyethoxy)propyl-[3-(2-methoxyethoxy)propyl-dimethylsilyl]oxy-dimethylsilane.
| Compound Name | 3-(2-methoxyethoxy)propyl-[3-(2-methoxyethoxy)propyl-dimethylsilyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 58607575 |
| Molecular Formula | C16H38O5Si2 |
| Molecular Weight | 366.65 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 3-(2-methoxyethoxy)propyl-[3-(2-methoxyethoxy)propyl-dimethylsilyl]oxy-dimethylsilane |
| SMILES | COCCOCCC[Si](C)(C)O[Si](C)(C)CCCOCCOC |
| InChI | InChI=1S/C16H38O5Si2/c1-17-11-13-19-9-7-15-22(3,4)21-23(5,6)16-8-10-20-14-12-18-2/h7-16H2,1-6H3 |
| InChIKey | QBMFCIIYMZZKPJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.65 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|