C10H26O2Si2 — CID 59691033
4-methoxybutyl-dimethyl-trimethylsilyloxysilane (PubChem CID 59691033) has the molecular formula C10H26O2Si2 and a molecular weight of 234.49 g/mol. Its IUPAC name is 4-methoxybutyl-dimethyl-trimethylsilyloxysilane.
| Compound Name | 4-methoxybutyl-dimethyl-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 59691033 |
| Molecular Formula | C10H26O2Si2 |
| Molecular Weight | 234.49 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 4-methoxybutyl-dimethyl-trimethylsilyloxysilane |
| SMILES | COCCCC[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C10H26O2Si2/c1-11-9-7-8-10-14(5,6)12-13(2,3)4/h7-10H2,1-6H3 |
| InChIKey | UEKPZRAJEARGOS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|