About dimethyl-pentyl-trimethylsilyloxysilane
dimethyl-pentyl-trimethylsilyloxysilane (PubChem CID 59128075) has the molecular formula C10H26OSi2
and a molecular weight of 218.49 g/mol. Its IUPAC name is dimethyl-pentyl-trimethylsilyloxysilane.
Molecular Properties
| Compound Name | dimethyl-pentyl-trimethylsilyloxysilane |
| PubChem CID | 59128075 |
| Molecular Formula | C10H26OSi2 |
| Molecular Weight | 218.49 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | dimethyl-pentyl-trimethylsilyloxysilane |
| SMILES | CCCCC[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C10H26OSi2/c1-7-8-9-10-13(5,6)11-12(2,3)4/h7-10H2,1-6H3 |
| InChIKey | OPOBGUPFZONHHV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-pentyl-trimethylsilyloxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-pentyl-trimethylsilyloxysilane?
The IUPAC name of dimethyl-pentyl-trimethylsilyloxysilane (CID 59128075) is dimethyl-pentyl-trimethylsilyloxysilane.
What is the SMILES notation for dimethyl-pentyl-trimethylsilyloxysilane?
The canonical SMILES for dimethyl-pentyl-trimethylsilyloxysilane is CCCCC[Si](C)(C)O[Si](C)(C)C.
What is the InChIKey of dimethyl-pentyl-trimethylsilyloxysilane?
The InChIKey is OPOBGUPFZONHHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H26OSi2/c1-7-8-9-10-13(5,6)11-12(2,3)4/h7-10H2,1-6H3.
What are the key properties of dimethyl-pentyl-trimethylsilyloxysilane?
dimethyl-pentyl-trimethylsilyloxysilane has a molecular weight of 218.49 g/mol, XLogP of 4.23, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-pentyl-trimethylsilyloxysilane is sourced from PubChem (CID 59128075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).