C15H40O5Si4 — CID 123979698
[dimethyl(trimethylsilyloxy)silyl]oxy-[2-(3-methoxypropoxy)ethyl]-methyl-trimethylsilyloxysilane (PubChem CID 123979698) has the molecular formula C15H40O5Si4 and a molecular weight of 412.82 g/mol. Its IUPAC name is [dimethyl(trimethylsilyloxy)silyl]oxy-[2-(3-methoxypropoxy)ethyl]-methyl-trimethylsilyloxysilane.
| Compound Name | [dimethyl(trimethylsilyloxy)silyl]oxy-[2-(3-methoxypropoxy)ethyl]-methyl-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 123979698 |
| Molecular Formula | C15H40O5Si4 |
| Molecular Weight | 412.82 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | [dimethyl(trimethylsilyloxy)silyl]oxy-[2-(3-methoxypropoxy)ethyl]-methyl-trimethylsilyloxysilane |
| SMILES | COCCCOCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H40O5Si4/c1-16-12-11-13-17-14-15-24(10,19-22(5,6)7)20-23(8,9)18-21(2,3)4/h11-15H2,1-10H3 |
| InChIKey | FTKSYGHRWBYDIY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.82 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|