C5F10HgO2 — CID 158462484
1,1,2,2,2-pentafluoroethylmercury(1+);2,2,3,3,3-pentafluoropropanoate (PubChem CID 158462484) has the molecular formula C5F10HgO2 and a molecular weight of 482.62 g/mol. Its IUPAC name is 1,1,2,2,2-pentafluoroethylmercury(1+);2,2,3,3,3-pentafluoropropanoate.
| Compound Name | 1,1,2,2,2-pentafluoroethylmercury(1+);2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 158462484 |
| Molecular Formula | C5F10HgO2 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 483.94 |
| IUPAC Name | 1,1,2,2,2-pentafluoroethylmercury(1+);2,2,3,3,3-pentafluoropropanoate |
| SMILES | FC(F)(F)C(F)(F)[Hg+].O=C([O-])C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C3HF5O2.C2F5.Hg/c4-2(5,1(9)10)3(6,7)8;3-1(4)2(5,6)7;/h(H,9,10);;/q;;+1/p-1 |
| InChIKey | HFIRZRBLUYDFEW-UHFFFAOYSA-M |
| XLogP | 1.62 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|