C4F11O2S- — CID 171040270
2,2,3,3,4,4-hexafluoro-4-(pentafluoro-λ6-sulfanyl)butanoate (PubChem CID 171040270) has the molecular formula C4F11O2S- and a molecular weight of 321.09 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexafluoro-4-(pentafluoro-λ6-sulfanyl)butanoate.
| Compound Name | 2,2,3,3,4,4-hexafluoro-4-(pentafluoro-λ6-sulfanyl)butanoate |
|---|---|
| PubChem CID | 171040270 |
| Molecular Formula | C4F11O2S- |
| Molecular Weight | 321.09 g/mol |
| Exact Mass | 320.94 |
| IUPAC Name | 2,2,3,3,4,4-hexafluoro-4-(pentafluoro-λ6-sulfanyl)butanoate |
| SMILES | O=C([O-])C(F)(F)C(F)(F)C(F)(F)S(F)(F)(F)(F)F |
| InChI | InChI=1S/C4HF11O2S/c5-2(6,1(16)17)3(7,8)4(9,10)18(11,12,13,14)15/h(H,16,17)/p-1 |
| InChIKey | FTCSJONJMHEDNH-UHFFFAOYSA-M |
| XLogP | 2.90 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.09 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|