C9HF21O2S — CID 139594321
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-9-(pentafluoro-λ6-sulfanyl)nonanoic acid (PubChem CID 139594321) has the molecular formula C9HF21O2S and a molecular weight of 572.13 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-9-(pentafluoro-λ6-sulfanyl)nonanoic acid.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-9-(pentafluoro-λ6-sulfanyl)nonanoic acid |
|---|---|
| PubChem CID | 139594321 |
| Molecular Formula | C9HF21O2S |
| Molecular Weight | 572.13 g/mol |
| Exact Mass | 571.94 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-9-(pentafluoro-λ6-sulfanyl)nonanoic acid |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(F)(F)(F)(F)F |
| InChI | InChI=1S/C9HF21O2S/c10-2(11,1(31)32)3(12,13)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)9(24,25)33(26,27,28,29)30/h(H,31,32) |
| InChIKey | BFUDGDVNRICWJX-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.13 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|