C11H6F14N2O4 — CID 130266645
3-[[2,2,3,4,4,4-hexafluoro-3-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)butanoyl]amino]propanoic acid (PubChem CID 130266645) has the molecular formula C11H6F14N2O4 and a molecular weight of 496.15 g/mol. Its IUPAC name is 3-[[2,2,3,4,4,4-hexafluoro-3-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)butanoyl]amino]propanoic acid.
| Compound Name | 3-[[2,2,3,4,4,4-hexafluoro-3-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)butanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 130266645 |
| Molecular Formula | C11H6F14N2O4 |
| Molecular Weight | 496.15 g/mol |
| Exact Mass | 496.01 |
| IUPAC Name | 3-[[2,2,3,4,4,4-hexafluoro-3-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)butanoyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)C(F)(F)C(F)(N1C(F)(F)C(F)(F)OC(F)(F)C1(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H6F14N2O4/c12-5(13,4(30)26-2-1-3(28)29)6(14,7(15,16)17)27-8(18,19)10(22,23)31-11(24,25)9(27,20)21/h1-2H2,(H,26,30)(H,28,29) |
| InChIKey | NWCXBFZPMSVOID-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.15 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|