C16H20F14N3O5S+ — CID 141475317
3-[[2-[difluoro-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)methyl]-2,3,3,3-tetrafluoropropanoyl]amino]propyl-dimethyl-(3-sulfopropyl)azanium (PubChem CID 141475317) has the molecular formula C16H20F14N3O5S+ and a molecular weight of 632.39 g/mol. Its IUPAC name is 3-[[2-[difluoro-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)methyl]-2,3,3,3-tetrafluoropropanoyl]amino]propyl-dimethyl-(3-sulfopropyl)azanium.
| Compound Name | 3-[[2-[difluoro-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)methyl]-2,3,3,3-tetrafluoropropanoyl]amino]propyl-dimethyl-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 141475317 |
| Molecular Formula | C16H20F14N3O5S+ |
| Molecular Weight | 632.39 g/mol |
| Exact Mass | 632.09 |
| IUPAC Name | 3-[[2-[difluoro-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)methyl]-2,3,3,3-tetrafluoropropanoyl]amino]propyl-dimethyl-(3-sulfopropyl)azanium |
| SMILES | C[N+](C)(CCCNC(=O)C(F)(C(F)(F)F)C(F)(F)N1C(F)(F)C(F)(F)OC(F)(F)C1(F)F)CCCS(=O)(=O)O |
| InChI | InChI=1S/C16H19F14N3O5S/c1-33(2,7-4-8-39(35,36)37)6-3-5-31-9(34)10(17,11(18,19)20)12(21,22)32-13(23,24)15(27,28)38-16(29,30)14(32,25)26/h3-8H2,1-2H3,(H-,31,34,35,36,37)/p+1 |
| InChIKey | SCTVJKYRLOKZAS-UHFFFAOYSA-O |
| XLogP | 3.41 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|