C14H31N2O6S+ — CID 153279829
3-[[2-(2-ethoxyethoxy)acetyl]amino]propyl-dimethyl-(3-sulfopropyl)azanium (PubChem CID 153279829) has the molecular formula C14H31N2O6S+ and a molecular weight of 355.48 g/mol. Its IUPAC name is 3-[[2-(2-ethoxyethoxy)acetyl]amino]propyl-dimethyl-(3-sulfopropyl)azanium.
| Compound Name | 3-[[2-(2-ethoxyethoxy)acetyl]amino]propyl-dimethyl-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 153279829 |
| Molecular Formula | C14H31N2O6S+ |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 3-[[2-(2-ethoxyethoxy)acetyl]amino]propyl-dimethyl-(3-sulfopropyl)azanium |
| SMILES | CCOCCOCC(=O)NCCC[N+](C)(C)CCCS(=O)(=O)O |
| InChI | InChI=1S/C14H30N2O6S/c1-4-21-10-11-22-13-14(17)15-7-5-8-16(2,3)9-6-12-23(18,19)20/h4-13H2,1-3H3,(H-,15,17,18,19,20)/p+1 |
| InChIKey | IGCDGEVOTCAHCD-UHFFFAOYSA-O |
| XLogP | -0.10 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|